C26H30N2O6S — CID 28902423
ethyl (3S)-1-[6-ethoxy-3-(4-methoxyphenyl)sulfonylquinolin-4-yl]piperidine-3-carboxylate (PubChem CID 28902423) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is ethyl (3S)-1-[6-ethoxy-3-(4-methoxyphenyl)sulfonylquinolin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[6-ethoxy-3-(4-methoxyphenyl)sulfonylquinolin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 28902423 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | ethyl (3S)-1-[6-ethoxy-3-(4-methoxyphenyl)sulfonylquinolin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2c(S(=O)(=O)c3ccc(OC)cc3)cnc3ccc(OCC)cc23)C1 |
| InChI | InChI=1S/C26H30N2O6S/c1-4-33-20-10-13-23-22(15-20)25(28-14-6-7-18(17-28)26(29)34-5-2)24(16-27-23)35(30,31)21-11-8-19(32-3)9-12-21/h8-13,15-16,18H,4-7,14,17H2,1-3H3/t18-/m0/s1 |
| InChIKey | JQGMBNWBNPIHEV-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |