C11H17N3O2 — CID 28903424
N-[6-(2-hydroxyethylamino)-3-pyridinyl]butanamide (PubChem CID 28903424) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-[6-(2-hydroxyethylamino)-3-pyridinyl]butanamide.
| Compound Name | N-[6-(2-hydroxyethylamino)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 28903424 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-[6-(2-hydroxyethylamino)-3-pyridinyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(NCCO)nc1 |
| InChI | InChI=1S/C11H17N3O2/c1-2-3-11(16)14-9-4-5-10(13-8-9)12-6-7-15/h4-5,8,15H,2-3,6-7H2,1H3,(H,12,13)(H,14,16) |
| InChIKey | AUQKUMVQIZBPCG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |