C16H16ClF3N4O4S — CID 28905907
methyl (3R,8aS)-7-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate (PubChem CID 28905907) has the molecular formula C16H16ClF3N4O4S and a molecular weight of 452.84 g/mol. Its IUPAC name is methyl (3R,8aS)-7-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate.
| Compound Name | methyl (3R,8aS)-7-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate |
|---|---|
| PubChem CID | 28905907 |
| Molecular Formula | C16H16ClF3N4O4S |
| Molecular Weight | 452.84 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | methyl (3R,8aS)-7-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazine-3-carboxylate |
| SMILES | COC(=O)[C@H]1SC[C@@H]2C(=O)N(CCNc3ncc(C(F)(F)F)cc3Cl)CC(=O)N21 |
| InChI | InChI=1S/C16H16ClF3N4O4S/c1-28-15(27)14-24-10(7-29-14)13(26)23(6-11(24)25)3-2-21-12-9(17)4-8(5-22-12)16(18,19)20/h4-5,10,14H,2-3,6-7H2,1H3,(H,21,22)/t10-,14-/m1/s1 |
| InChIKey | GZUPUCRLNRXLLD-QMTHXVAHSA-N |
| XLogP | 1.45 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.84 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |