C26H29NO7 — CID 28906271
3-O-cyclopentyl 6-O-methyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 28906271) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 3-O-cyclopentyl 6-O-methyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-cyclopentyl 6-O-methyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 28906271 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-O-cyclopentyl 6-O-methyl (4R,6S,7S)-4-(1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C2=C(C[C@@H]1C)NC(C)=C(C(=O)OC1CCCC1)[C@@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H29NO7/c1-13-10-17-23(24(28)20(13)25(29)31-3)22(15-8-9-18-19(11-15)33-12-32-18)21(14(2)27-17)26(30)34-16-6-4-5-7-16/h8-9,11,13,16,20,22,27H,4-7,10,12H2,1-3H3/t13-,20-,22-/m0/s1 |
| InChIKey | LVZAWGXKFNVHAI-JYYJXNPCSA-N |
| XLogP | 3.51 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|