About N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide
N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 2890764) has the molecular formula C12H17NO5S
and a molecular weight of 287.34 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| PubChem CID | 2890764 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | COCCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H17NO5S/c1-16-6-2-5-13-19(14,15)10-3-4-11-12(9-10)18-8-7-17-11/h3-4,9,13H,2,5-8H2,1H3 |
| InChIKey | ISFZYXLYASVMBQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The IUPAC name of N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CID 2890764) is N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
What is the SMILES notation for N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The canonical SMILES for N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide is COCCCNS(=O)(=O)c1ccc2c(c1)OCCO2.
What is the InChIKey of N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
The InChIKey is ISFZYXLYASVMBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5S/c1-16-6-2-5-13-19(14,15)10-3-4-11-12(9-10)18-8-7-17-11/h3-4,9,13H,2,5-8H2,1H3.
What are the key properties of N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide?
N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide has a molecular weight of 287.34 g/mol, XLogP of 0.77, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide is sourced from PubChem (CID 2890764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).