C21H21NO5 — CID 2891138
3-acetyl-1-benzyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 2891138) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 3-acetyl-1-benzyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-1-benzyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 2891138 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3-acetyl-1-benzyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | COc1ccc(C2C(C(C)=O)=C(O)C(=O)N2Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C21H21NO5/c1-13(23)18-19(16-10-9-15(26-2)11-17(16)27-3)22(21(25)20(18)24)12-14-7-5-4-6-8-14/h4-11,19,24H,12H2,1-3H3 |
| InChIKey | ASYQMTCCGSMVMU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |