C18H19ClO6 — CID 28913618
propan-2-yl 5-[(2-chloro-6-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylate (PubChem CID 28913618) has the molecular formula C18H19ClO6 and a molecular weight of 366.80 g/mol. Its IUPAC name is propan-2-yl 5-[(2-chloro-6-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylate.
| Compound Name | propan-2-yl 5-[(2-chloro-6-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 28913618 |
| Molecular Formula | C18H19ClO6 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | propan-2-yl 5-[(2-chloro-6-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(C=O)cc(Cl)c1OCc1ccc(C(=O)OC(C)C)o1 |
| InChI | InChI=1S/C18H19ClO6/c1-4-22-16-8-12(9-20)7-14(19)17(16)23-10-13-5-6-15(25-13)18(21)24-11(2)3/h5-9,11H,4,10H2,1-3H3 |
| InChIKey | VDTGSSIAHMAGTJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|