C21H22N4OS — CID 28913833
1-(4-methylphenyl)-6-[(1S)-1-phenylethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 28913833) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)-6-[(1S)-1-phenylethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 1-(4-methylphenyl)-6-[(1S)-1-phenylethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28913833 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-(4-methylphenyl)-6-[(1S)-1-phenylethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-n2c3c(c(=O)[nH]c2=S)CN([C@@H](C)c2ccccc2)CN3)cc1 |
| InChI | InChI=1S/C21H22N4OS/c1-14-8-10-17(11-9-14)25-19-18(20(26)23-21(25)27)12-24(13-22-19)15(2)16-6-4-3-5-7-16/h3-11,15,22H,12-13H2,1-2H3,(H,23,26,27)/t15-/m0/s1 |
| InChIKey | IDWXDDSLJWNWAT-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|