C24H28FN3O3 — CID 2891523
N-[(Z)-1-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide (PubChem CID 2891523) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-[(Z)-1-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide.
| Compound Name | N-[(Z)-1-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 2891523 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[(Z)-1-(4-fluorophenyl)-3-(3-morpholin-4-ylpropylamino)-3-oxoprop-1-en-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(=C\c2ccc(F)cc2)C(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H28FN3O3/c1-18-3-7-20(8-4-18)23(29)27-22(17-19-5-9-21(25)10-6-19)24(30)26-11-2-12-28-13-15-31-16-14-28/h3-10,17H,2,11-16H2,1H3,(H,26,30)(H,27,29)/b22-17- |
| InChIKey | XIHBIUUFLQQPKT-XLNRJJMWSA-N |
| XLogP | 2.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|