C23H28N2O4 — CID 2891565
bis(prop-2-enyl) 4-[4-(dimethylamino)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 2891565) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is bis(prop-2-enyl) 4-[4-(dimethylamino)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 4-[4-(dimethylamino)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 2891565 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | bis(prop-2-enyl) 4-[4-(dimethylamino)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=C)C1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-7-13-28-22(26)19-15(3)24-16(4)20(23(27)29-14-8-2)21(19)17-9-11-18(12-10-17)25(5)6/h7-12,21,24H,1-2,13-14H2,3-6H3 |
| InChIKey | HEOZIWLUGOWCQN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|