About 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine
3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine (PubChem CID 28915758) has the molecular formula C11H20N4S
and a molecular weight of 240.38 g/mol. Its IUPAC name is 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine |
| PubChem CID | 28915758 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine |
| SMILES | NCCCSc1n[nH]c(C2CCCCC2)n1 |
| InChI | InChI=1S/C11H20N4S/c12-7-4-8-16-11-13-10(14-15-11)9-5-2-1-3-6-9/h9H,1-8,12H2,(H,13,14,15) |
| InChIKey | JBCFMEDNJGIZMM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine?
The IUPAC name of 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine (CID 28915758) is 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine.
What is the SMILES notation for 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine?
The canonical SMILES for 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine is NCCCSc1n[nH]c(C2CCCCC2)n1.
What is the InChIKey of 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine?
The InChIKey is JBCFMEDNJGIZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4S/c12-7-4-8-16-11-13-10(14-15-11)9-5-2-1-3-6-9/h9H,1-8,12H2,(H,13,14,15).
What are the key properties of 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine?
3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine has a molecular weight of 240.38 g/mol, XLogP of 2.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-cyclohexyl-1H-1,2,4-triazol-3-yl)sulfanyl]propan-1-amine is sourced from PubChem (CID 28915758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).