C23H27NO6 — CID 2892029
bis(prop-2-enyl) 4-(3-ethoxy-4-hydroxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 2892029) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is bis(prop-2-enyl) 4-(3-ethoxy-4-hydroxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 4-(3-ethoxy-4-hydroxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 2892029 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | bis(prop-2-enyl) 4-(3-ethoxy-4-hydroxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC=C)C1c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C23H27NO6/c1-6-11-29-22(26)19-14(4)24-15(5)20(23(27)30-12-7-2)21(19)16-9-10-17(25)18(13-16)28-8-3/h6-7,9-10,13,21,24-25H,1-2,8,11-12H2,3-5H3 |
| InChIKey | HDMRPBAVAOZSDL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|