C20H26N2O3S — CID 28922005
1-benzyl-4-[(S)-(2,4-dimethoxy-3-methylphenyl)sulfinyl]piperazine (PubChem CID 28922005) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-benzyl-4-[(S)-(2,4-dimethoxy-3-methylphenyl)sulfinyl]piperazine.
| Compound Name | 1-benzyl-4-[(S)-(2,4-dimethoxy-3-methylphenyl)sulfinyl]piperazine |
|---|---|
| PubChem CID | 28922005 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-benzyl-4-[(S)-(2,4-dimethoxy-3-methylphenyl)sulfinyl]piperazine |
| SMILES | COc1ccc([S@](=O)N2CCN(Cc3ccccc3)CC2)c(OC)c1C |
| InChI | InChI=1S/C20H26N2O3S/c1-16-18(24-2)9-10-19(20(16)25-3)26(23)22-13-11-21(12-14-22)15-17-7-5-4-6-8-17/h4-10H,11-15H2,1-3H3/t26-/m0/s1 |
| InChIKey | BBOUBXORLZSKLJ-SANMLTNESA-N |
| XLogP | 2.85 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |