C25H23ClN2O6 — CID 2892239
methyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 2892239) has the molecular formula C25H23ClN2O6 and a molecular weight of 482.92 g/mol. Its IUPAC name is methyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | methyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 2892239 |
| Molecular Formula | C25H23ClN2O6 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | methyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)CCC2)C1c1ccc(OCc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H23ClN2O6/c1-14-22(25(30)33-2)23(24-18(27-14)4-3-5-20(24)29)16-8-11-21(19(12-16)28(31)32)34-13-15-6-9-17(26)10-7-15/h6-12,23,27H,3-5,13H2,1-2H3 |
| InChIKey | SSWIPWROGPGMBU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|