C12H12N2O3 — CID 2892394
1-(2-ethylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2892394) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-ethylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2892394 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(2-ethylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCc1ccccc1N1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O3/c1-2-8-5-3-4-6-9(8)14-11(16)7-10(15)13-12(14)17/h3-6H,2,7H2,1H3,(H,13,15,17) |
| InChIKey | TYBRNGGSYFYIRM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|