C16H14BrN3O2S3 — CID 2892497
3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5-dihydro-1,3-thiazol-2-yl)propanamide (PubChem CID 2892497) has the molecular formula C16H14BrN3O2S3 and a molecular weight of 456.41 g/mol. Its IUPAC name is 3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5-dihydro-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5-dihydro-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 2892497 |
| Molecular Formula | C16H14BrN3O2S3 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | 3-[5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4,5-dihydro-1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C(=Cc2cccc(Br)c2)SC1=S)NC1=NCCS1 |
| InChI | InChI=1S/C16H14BrN3O2S3/c17-11-3-1-2-10(8-11)9-12-14(22)20(16(23)25-12)6-4-13(21)19-15-18-5-7-24-15/h1-3,8-9H,4-7H2,(H,18,19,21) |
| InChIKey | KOVOTTFNMAEFRF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|