C29H24N2O5 — CID 2892593
5-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-2-morpholin-4-ylbenzoic acid (PubChem CID 2892593) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is 5-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-2-morpholin-4-ylbenzoic acid.
| Compound Name | 5-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-2-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 2892593 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 5-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)-2-morpholin-4-ylbenzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C29H24N2O5/c32-27-25-23-17-5-1-2-6-18(17)24(20-8-4-3-7-19(20)23)26(25)28(33)31(27)16-9-10-22(21(15-16)29(34)35)30-11-13-36-14-12-30/h1-10,15,23-26H,11-14H2,(H,34,35) |
| InChIKey | AUUMSPLIEMMDMQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|