C24H29NO5 — CID 2892779
N,N-diethyl-5-(4-methoxyphenyl)-5-phenylpent-2-yn-1-amine;oxalic acid (PubChem CID 2892779) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is N,N-diethyl-5-(4-methoxyphenyl)-5-phenylpent-2-yn-1-amine;oxalic acid.
| Compound Name | N,N-diethyl-5-(4-methoxyphenyl)-5-phenylpent-2-yn-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2892779 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N,N-diethyl-5-(4-methoxyphenyl)-5-phenylpent-2-yn-1-amine;oxalic acid |
| SMILES | CCN(CC)CC#CCC(c1ccccc1)c1ccc(OC)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27NO.C2H2O4/c1-4-23(5-2)18-10-9-13-22(19-11-7-6-8-12-19)20-14-16-21(24-3)17-15-20;3-1(4)2(5)6/h6-8,11-12,14-17,22H,4-5,13,18H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | KOVDUJSQZWKFFO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|