About 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride
1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride (PubChem CID 2892832) has the molecular formula C16H32ClNO3
and a molecular weight of 321.89 g/mol. Its IUPAC name is 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride |
| PubChem CID | 2892832 |
| Molecular Formula | C16H32ClNO3 |
| Molecular Weight | 321.89 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride |
| SMILES | CC1CC(OCC(O)CN2CCOCC2)CC(C)(C)C1.Cl |
| InChI | InChI=1S/C16H31NO3.ClH/c1-13-8-15(10-16(2,3)9-13)20-12-14(18)11-17-4-6-19-7-5-17;/h13-15,18H,4-12H2,1-3H3;1H |
| InChIKey | PMKKBSQOKWUGGE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.89 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
The IUPAC name of 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride (CID 2892832) is 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride.
What is the SMILES notation for 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
The canonical SMILES for 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride is CC1CC(OCC(O)CN2CCOCC2)CC(C)(C)C1.Cl.
What is the InChIKey of 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
The InChIKey is PMKKBSQOKWUGGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO3.ClH/c1-13-8-15(10-16(2,3)9-13)20-12-14(18)11-17-4-6-19-7-5-17;/h13-15,18H,4-12H2,1-3H3;1H.
What are the key properties of 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride has a molecular weight of 321.89 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-yl-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride is sourced from PubChem (CID 2892832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).