C21H18N2O2 — CID 2893153
3-[(3-methylphenyl)methyl]-1-quinolin-2-ylpyrrolidine-2,5-dione (PubChem CID 2893153) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[(3-methylphenyl)methyl]-1-quinolin-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-[(3-methylphenyl)methyl]-1-quinolin-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2893153 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-[(3-methylphenyl)methyl]-1-quinolin-2-ylpyrrolidine-2,5-dione |
| SMILES | Cc1cccc(CC2CC(=O)N(c3ccc4ccccc4n3)C2=O)c1 |
| InChI | InChI=1S/C21H18N2O2/c1-14-5-4-6-15(11-14)12-17-13-20(24)23(21(17)25)19-10-9-16-7-2-3-8-18(16)22-19/h2-11,17H,12-13H2,1H3 |
| InChIKey | MWYUDYWPAZCWCX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|