C8H13N3O5 — CID 28931731
5-[(2-amino-2-oxoethyl)carbamoylamino]-5-oxopentanoic acid (PubChem CID 28931731) has the molecular formula C8H13N3O5 and a molecular weight of 231.21 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethyl)carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(2-amino-2-oxoethyl)carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 28931731 |
| Molecular Formula | C8H13N3O5 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 5-[(2-amino-2-oxoethyl)carbamoylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CNC(=O)NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C8H13N3O5/c9-5(12)4-10-8(16)11-6(13)2-1-3-7(14)15/h1-4H2,(H2,9,12)(H,14,15)(H2,10,11,13,16) |
| InChIKey | ZENAEAKXHNGCAD-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |