C16H15FO3 — CID 28932941
4-[(2-fluorophenyl)methoxy]-3,5-dimethylbenzoic acid (PubChem CID 28932941) has the molecular formula C16H15FO3 and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methoxy]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[(2-fluorophenyl)methoxy]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 28932941 |
| Molecular Formula | C16H15FO3 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-[(2-fluorophenyl)methoxy]-3,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OCc1ccccc1F |
| InChI | InChI=1S/C16H15FO3/c1-10-7-13(16(18)19)8-11(2)15(10)20-9-12-5-3-4-6-14(12)17/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | NOMVXZIYMBYGLO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |