C11H6Br3F4NO — CID 28936618
(1R)-2,2,3,3-tetrafluoro-N-(3,4,5-tribromophenyl)cyclobutane-1-carboxamide (PubChem CID 28936618) has the molecular formula C11H6Br3F4NO and a molecular weight of 483.88 g/mol. Its IUPAC name is (1R)-2,2,3,3-tetrafluoro-N-(3,4,5-tribromophenyl)cyclobutane-1-carboxamide.
| Compound Name | (1R)-2,2,3,3-tetrafluoro-N-(3,4,5-tribromophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 28936618 |
| Molecular Formula | C11H6Br3F4NO |
| Molecular Weight | 483.88 g/mol |
| Exact Mass | 480.79 |
| IUPAC Name | (1R)-2,2,3,3-tetrafluoro-N-(3,4,5-tribromophenyl)cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1cc(Br)c(Br)c(Br)c1)[C@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C11H6Br3F4NO/c12-6-1-4(2-7(13)8(6)14)19-9(20)5-3-10(15,16)11(5,17)18/h1-2,5H,3H2,(H,19,20)/t5-/m1/s1 |
| InChIKey | YDIXOUUASLAQPD-RXMQYKEDSA-N |
| XLogP | 5.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|