C12H11Cl2N — CID 28937665
1-(2,6-dichlorophenyl)cyclopentane-1-carbonitrile (PubChem CID 28937665) has the molecular formula C12H11Cl2N and a molecular weight of 240.13 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)cyclopentane-1-carbonitrile.
| Compound Name | 1-(2,6-dichlorophenyl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 28937665 |
| Molecular Formula | C12H11Cl2N |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)cyclopentane-1-carbonitrile |
| SMILES | N#CC1(c2c(Cl)cccc2Cl)CCCC1 |
| InChI | InChI=1S/C12H11Cl2N/c13-9-4-3-5-10(14)11(9)12(8-15)6-1-2-7-12/h3-5H,1-2,6-7H2 |
| InChIKey | XVNLTKNIZUMKNH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |