C19H21N7OS2 — CID 2893833
2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 2893833) has the molecular formula C19H21N7OS2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2893833 |
| Molecular Formula | C19H21N7OS2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCCc1nnc(NC(=O)C(CC)Sc2nnc3c4ccccc4n(C)c3n2)s1 |
| InChI | InChI=1S/C19H21N7OS2/c1-4-8-14-22-24-19(29-14)21-17(27)13(5-2)28-18-20-16-15(23-25-18)11-9-6-7-10-12(11)26(16)3/h6-7,9-10,13H,4-5,8H2,1-3H3,(H,21,24,27) |
| InChIKey | GKJCDTHMORIEBF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |