About [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate
[3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate (PubChem CID 2893982) has the molecular formula C20H24N2O10
and a molecular weight of 452.42 g/mol. Its IUPAC name is [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate |
| PubChem CID | 2893982 |
| Molecular Formula | C20H24N2O10 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(NC(=O)c2cccnc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H24N2O10/c1-10(23)28-9-15-17(29-11(2)24)18(30-12(3)25)16(20(32-15)31-13(4)26)22-19(27)14-6-5-7-21-8-14/h5-8,15-18,20H,9H2,1-4H3,(H,22,27) |
| InChIKey | JUXCRMPAZJANBT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate?
The IUPAC name of [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate (CID 2893982) is [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate.
What is the SMILES notation for [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate?
The canonical SMILES for [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate is CC(=O)OCC1OC(OC(C)=O)C(NC(=O)c2cccnc2)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate?
The InChIKey is JUXCRMPAZJANBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O10/c1-10(23)28-9-15-17(29-11(2)24)18(30-12(3)25)16(20(32-15)31-13(4)26)22-19(27)14-6-5-7-21-8-14/h5-8,15-18,20H,9H2,1-4H3,(H,22,27).
What are the key properties of [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate?
[3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate has a molecular weight of 452.42 g/mol, XLogP of -0.11, 7 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4,6-triacetyloxy-5-(pyridine-3-carbonylamino)oxan-2-yl]methyl acetate is sourced from PubChem (CID 2893982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).