C10H23N3O2S — CID 28940686
1-(aminomethyl)-1-(dimethylsulfamoylamino)-4-methylcyclohexane (PubChem CID 28940686) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(aminomethyl)-1-(dimethylsulfamoylamino)-4-methylcyclohexane.
| Compound Name | 1-(aminomethyl)-1-(dimethylsulfamoylamino)-4-methylcyclohexane |
|---|---|
| PubChem CID | 28940686 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(aminomethyl)-1-(dimethylsulfamoylamino)-4-methylcyclohexane |
| SMILES | CC1CCC(CN)(NS(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C10H23N3O2S/c1-9-4-6-10(8-11,7-5-9)12-16(14,15)13(2)3/h9,12H,4-8,11H2,1-3H3 |
| InChIKey | GFVVGTSFQNTGNX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |