C13H29N3O2S — CID 28940746
1-(aminomethyl)-1-(diethylsulfamoylamino)-4-ethylcyclohexane (PubChem CID 28940746) has the molecular formula C13H29N3O2S and a molecular weight of 291.46 g/mol. Its IUPAC name is 1-(aminomethyl)-1-(diethylsulfamoylamino)-4-ethylcyclohexane.
| Compound Name | 1-(aminomethyl)-1-(diethylsulfamoylamino)-4-ethylcyclohexane |
|---|---|
| PubChem CID | 28940746 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-(aminomethyl)-1-(diethylsulfamoylamino)-4-ethylcyclohexane |
| SMILES | CCC1CCC(CN)(NS(=O)(=O)N(CC)CC)CC1 |
| InChI | InChI=1S/C13H29N3O2S/c1-4-12-7-9-13(11-14,10-8-12)15-19(17,18)16(5-2)6-3/h12,15H,4-11,14H2,1-3H3 |
| InChIKey | UCXUZPUQSDGSRC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |