About 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide
1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide (PubChem CID 2894140) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide |
| PubChem CID | 2894140 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCCN2N)cc1OC |
| InChI | InChI=1S/C14H21N3O3/c1-19-12-7-6-10(9-13(12)20-2)16-14(18)11-5-3-4-8-17(11)15/h6-7,9,11H,3-5,8,15H2,1-2H3,(H,16,18) |
| InChIKey | VCCLMWQUDILKTA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide?
The IUPAC name of 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide (CID 2894140) is 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide.
What is the SMILES notation for 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide?
The canonical SMILES for 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide is COc1ccc(NC(=O)C2CCCCN2N)cc1OC.
What is the InChIKey of 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide?
The InChIKey is VCCLMWQUDILKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-19-12-7-6-10(9-13(12)20-2)16-14(18)11-5-3-4-8-17(11)15/h6-7,9,11H,3-5,8,15H2,1-2H3,(H,16,18).
What are the key properties of 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide?
1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide has a molecular weight of 279.34 g/mol, XLogP of 1.37, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-(3,4-dimethoxyphenyl)piperidine-2-carboxamide is sourced from PubChem (CID 2894140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).