About 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole
3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole (PubChem CID 28941965) has the molecular formula C9H5Cl3N2O
and a molecular weight of 263.51 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole |
| PubChem CID | 28941965 |
| Molecular Formula | C9H5Cl3N2O |
| Molecular Weight | 263.51 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole |
| SMILES | ClCc1noc(-c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C9H5Cl3N2O/c10-4-7-13-9(15-14-7)5-2-1-3-6(11)8(5)12/h1-3H,4H2 |
| InChIKey | RYTCZGKVPLJNMI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole?
The IUPAC name of 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole (CID 28941965) is 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole?
The canonical SMILES for 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole is ClCc1noc(-c2cccc(Cl)c2Cl)n1.
What is the InChIKey of 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole?
The InChIKey is RYTCZGKVPLJNMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl3N2O/c10-4-7-13-9(15-14-7)5-2-1-3-6(11)8(5)12/h1-3H,4H2.
What are the key properties of 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole?
3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole has a molecular weight of 263.51 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole is sourced from PubChem (CID 28941965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).