About N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide
N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide (PubChem CID 28942) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide |
| PubChem CID | 28942 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide |
| SMILES | CNc1ccc(NC(C)=O)ccc1=O |
| InChI | InChI=1S/C10H12N2O2/c1-7(13)12-8-3-5-9(11-2)10(14)6-4-8/h3-6H,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | RFMKTEVOKJTKOQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide?
The IUPAC name of N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide (CID 28942) is N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide.
What is the SMILES notation for N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide?
The canonical SMILES for N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide is CNc1ccc(NC(C)=O)ccc1=O.
What is the InChIKey of N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide?
The InChIKey is RFMKTEVOKJTKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-7(13)12-8-3-5-9(11-2)10(14)6-4-8/h3-6H,1-2H3,(H,11,14)(H,12,13).
What are the key properties of N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide?
N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide has a molecular weight of 192.22 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(methylamino)-5-oxocyclohepta-1,3,6-trien-1-yl]acetamide is sourced from PubChem (CID 28942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).