About ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate
ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate (PubChem CID 28942120) has the molecular formula C15H17NO3S
and a molecular weight of 291.37 g/mol. Its IUPAC name is ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate.
Analyze ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate?
The IUPAC name of ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate (CID 28942120) is ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate.
What is the SMILES notation for ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate?
The canonical SMILES for ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate is CCOC(=O)Cc1nc(-c2cc(C)ccc2OC)cs1.
What is the InChIKey of ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate?
The InChIKey is FQEOOTCLSSWKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S/c1-4-19-15(17)8-14-16-12(9-20-14)11-7-10(2)5-6-13(11)18-3/h5-7,9H,4,8H2,1-3H3.
What are the key properties of ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate?
ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate has a molecular weight of 291.37 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-(2-methoxy-5-methylphenyl)-1,3-thiazol-2-yl]acetate is sourced from PubChem (CID 28942120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).