About 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione
5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione (PubChem CID 2894221) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione.
Molecular Properties
| Compound Name | 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione |
| PubChem CID | 2894221 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione |
| SMILES | CCCC1OC(=O)C(C)(C)C(=O)C1CC |
| InChI | InChI=1S/C12H20O3/c1-5-7-9-8(6-2)10(13)12(3,4)11(14)15-9/h8-9H,5-7H2,1-4H3 |
| InChIKey | BSGWAKRNHQWCMF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione?
The IUPAC name of 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione (CID 2894221) is 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione.
What is the SMILES notation for 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione?
The canonical SMILES for 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione is CCCC1OC(=O)C(C)(C)C(=O)C1CC.
What is the InChIKey of 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione?
The InChIKey is BSGWAKRNHQWCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-5-7-9-8(6-2)10(13)12(3,4)11(14)15-9/h8-9H,5-7H2,1-4H3.
What are the key properties of 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione?
5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione has a molecular weight of 212.29 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,3-dimethyl-6-propyloxane-2,4-dione is sourced from PubChem (CID 2894221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).