About 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol
3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol (PubChem CID 28942305) has the molecular formula C14H17NOS
and a molecular weight of 247.36 g/mol. Its IUPAC name is 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol |
| PubChem CID | 28942305 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol |
| SMILES | CCCc1nc(-c2cccc(O)c2)sc1CC |
| InChI | InChI=1S/C14H17NOS/c1-3-6-12-13(4-2)17-14(15-12)10-7-5-8-11(16)9-10/h5,7-9,16H,3-4,6H2,1-2H3 |
| InChIKey | VUSZLIDLGWJNGE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol?
The IUPAC name of 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol (CID 28942305) is 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol.
What is the SMILES notation for 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol?
The canonical SMILES for 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol is CCCc1nc(-c2cccc(O)c2)sc1CC.
What is the InChIKey of 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol?
The InChIKey is VUSZLIDLGWJNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NOS/c1-3-6-12-13(4-2)17-14(15-12)10-7-5-8-11(16)9-10/h5,7-9,16H,3-4,6H2,1-2H3.
What are the key properties of 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol?
3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol has a molecular weight of 247.36 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-4-propyl-1,3-thiazol-2-yl)phenol is sourced from PubChem (CID 28942305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).