About [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate
[2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate (PubChem CID 2894448) has the molecular formula C21H19BrO4
and a molecular weight of 415.28 g/mol. Its IUPAC name is [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate |
| PubChem CID | 2894448 |
| Molecular Formula | C21H19BrO4 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate |
| SMILES | CC1=C(OC(=O)c2ccccc2)C(C)(C)C(c2ccc(Br)cc2)OC1=O |
| InChI | InChI=1S/C21H19BrO4/c1-13-17(25-20(24)15-7-5-4-6-8-15)21(2,3)18(26-19(13)23)14-9-11-16(22)12-10-14/h4-12,18H,1-3H3 |
| InChIKey | CTGVFOIXEATLQC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate?
The IUPAC name of [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate (CID 2894448) is [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate.
What is the SMILES notation for [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate?
The canonical SMILES for [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate is CC1=C(OC(=O)c2ccccc2)C(C)(C)C(c2ccc(Br)cc2)OC1=O.
What is the InChIKey of [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate?
The InChIKey is CTGVFOIXEATLQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19BrO4/c1-13-17(25-20(24)15-7-5-4-6-8-15)21(2,3)18(26-19(13)23)14-9-11-16(22)12-10-14/h4-12,18H,1-3H3.
What are the key properties of [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate?
[2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate has a molecular weight of 415.28 g/mol, XLogP of 5.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-3,3,5-trimethyl-6-oxo-2H-pyran-4-yl] benzoate is sourced from PubChem (CID 2894448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).