About 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol
2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol (PubChem CID 2894559) has the molecular formula C21H25Cl2NO
and a molecular weight of 378.34 g/mol. Its IUPAC name is 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol |
| PubChem CID | 2894559 |
| Molecular Formula | C21H25Cl2NO |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol |
| SMILES | CCC1(O)C(C)C(c2ccc(Cl)cc2)NC(c2ccc(Cl)cc2)C1C |
| InChI | InChI=1S/C21H25Cl2NO/c1-4-21(25)13(2)19(15-5-9-17(22)10-6-15)24-20(14(21)3)16-7-11-18(23)12-8-16/h5-14,19-20,24-25H,4H2,1-3H3 |
| InChIKey | LRKCWFYHHUSIOT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol?
The IUPAC name of 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol (CID 2894559) is 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol.
What is the SMILES notation for 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol?
The canonical SMILES for 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol is CCC1(O)C(C)C(c2ccc(Cl)cc2)NC(c2ccc(Cl)cc2)C1C.
What is the InChIKey of 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol?
The InChIKey is LRKCWFYHHUSIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25Cl2NO/c1-4-21(25)13(2)19(15-5-9-17(22)10-6-15)24-20(14(21)3)16-7-11-18(23)12-8-16/h5-14,19-20,24-25H,4H2,1-3H3.
What are the key properties of 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol?
2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol has a molecular weight of 378.34 g/mol, XLogP of 5.79, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(4-chlorophenyl)-4-ethyl-3,5-dimethylpiperidin-4-ol is sourced from PubChem (CID 2894559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).