About 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline
1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline (PubChem CID 28946471) has the molecular formula C17H17Cl2N
and a molecular weight of 306.24 g/mol. Its IUPAC name is 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 28946471 |
| Molecular Formula | C17H17Cl2N |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccc2c(c1)CCCN2c1cccc(Cl)c1CCl |
| InChI | InChI=1S/C17H17Cl2N/c1-12-7-8-16-13(10-12)4-3-9-20(16)17-6-2-5-15(19)14(17)11-18/h2,5-8,10H,3-4,9,11H2,1H3 |
| InChIKey | ZTEHWDLPFZCDIA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline (CID 28946471) is 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline is Cc1ccc2c(c1)CCCN2c1cccc(Cl)c1CCl.
What is the InChIKey of 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is ZTEHWDLPFZCDIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl2N/c1-12-7-8-16-13(10-12)4-3-9-20(16)17-6-2-5-15(19)14(17)11-18/h2,5-8,10H,3-4,9,11H2,1H3.
What are the key properties of 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline?
1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 306.24 g/mol, XLogP of 5.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-chloro-2-(chloromethyl)phenyl]-6-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 28946471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).