About 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole
1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole (PubChem CID 28946541) has the molecular formula C12H12ClFN2
and a molecular weight of 238.69 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole |
| PubChem CID | 28946541 |
| Molecular Formula | C12H12ClFN2 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(-c2ccc(CCl)cc2F)n1 |
| InChI | InChI=1S/C12H12ClFN2/c1-8-5-9(2)16(15-8)12-4-3-10(7-13)6-11(12)14/h3-6H,7H2,1-2H3 |
| InChIKey | WVTDVYYZTPGZKE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole?
The IUPAC name of 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole (CID 28946541) is 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole.
What is the SMILES notation for 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole?
The canonical SMILES for 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole is Cc1cc(C)n(-c2ccc(CCl)cc2F)n1.
What is the InChIKey of 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole?
The InChIKey is WVTDVYYZTPGZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClFN2/c1-8-5-9(2)16(15-8)12-4-3-10(7-13)6-11(12)14/h3-6H,7H2,1-2H3.
What are the key properties of 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole?
1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole has a molecular weight of 238.69 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(chloromethyl)-2-fluorophenyl]-3,5-dimethylpyrazole is sourced from PubChem (CID 28946541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).