About N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide
N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide (PubChem CID 28946840) has the molecular formula C21H18FN3O3S
and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide |
| PubChem CID | 28946840 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@@]1(C)NS(=O)(=O)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C21H18FN3O3S/c1-14-21(2,20(26)25(23-14)15-8-4-3-5-9-15)24-29(27,28)19-13-12-18(22)16-10-6-7-11-17(16)19/h3-13,24H,1-2H3/t21-/m0/s1 |
| InChIKey | JQIWWRWRDXOZIK-NRFANRHFSA-N |
| XLogP | 3.44 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide?
The IUPAC name of N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide (CID 28946840) is N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide.
What is the SMILES notation for N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide?
The canonical SMILES for N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide is CC1=NN(c2ccccc2)C(=O)[C@@]1(C)NS(=O)(=O)c1ccc(F)c2ccccc12.
What is the InChIKey of N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide?
The InChIKey is JQIWWRWRDXOZIK-NRFANRHFSA-N. The full InChI is InChI=1S/C21H18FN3O3S/c1-14-21(2,20(26)25(23-14)15-8-4-3-5-9-15)24-29(27,28)19-13-12-18(22)16-10-6-7-11-17(16)19/h3-13,24H,1-2H3/t21-/m0/s1.
What are the key properties of N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide?
N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide has a molecular weight of 411.46 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-3,4-dimethyl-5-oxo-1-phenylpyrazol-4-yl]-4-fluoronaphthalene-1-sulfonamide is sourced from PubChem (CID 28946840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).