C26H29NO2 — CID 28949289
(1S,2S)-1-(4-methylphenyl)-3-morpholin-4-yl-1,2-diphenylpropan-1-ol (PubChem CID 28949289) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (1S,2S)-1-(4-methylphenyl)-3-morpholin-4-yl-1,2-diphenylpropan-1-ol.
| Compound Name | (1S,2S)-1-(4-methylphenyl)-3-morpholin-4-yl-1,2-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 28949289 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (1S,2S)-1-(4-methylphenyl)-3-morpholin-4-yl-1,2-diphenylpropan-1-ol |
| SMILES | Cc1ccc([C@@](O)(c2ccccc2)[C@H](CN2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO2/c1-21-12-14-24(15-13-21)26(28,23-10-6-3-7-11-23)25(22-8-4-2-5-9-22)20-27-16-18-29-19-17-27/h2-15,25,28H,16-20H2,1H3/t25-,26+/m1/s1 |
| InChIKey | BBUXSGAOMXEODN-FTJBHMTQSA-N |
| XLogP | 4.35 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |