About 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 28950220) has the molecular formula C7H6N2O2S
and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| PubChem CID | 28950220 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| SMILES | Cc1cn2cc(C(=O)O)nc2s1 |
| InChI | InChI=1S/C7H6N2O2S/c1-4-2-9-3-5(6(10)11)8-7(9)12-4/h2-3H,1H3,(H,10,11) |
| InChIKey | NEIIRHYEZKVAKX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The IUPAC name of 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (CID 28950220) is 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
What is the SMILES notation for 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The canonical SMILES for 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is Cc1cn2cc(C(=O)O)nc2s1.
What is the InChIKey of 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The InChIKey is NEIIRHYEZKVAKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2S/c1-4-2-9-3-5(6(10)11)8-7(9)12-4/h2-3H,1H3,(H,10,11).
What are the key properties of 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid has a molecular weight of 182.20 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is sourced from PubChem (CID 28950220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).