5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid

C7H7NO2S — CID 28950332

IUPAC5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid
SMILESO=C(O)c1nc2c(s1)CCC2
InChIInChI=1S/C7H7NO2S/c9-7(10)6-8-4-2-1-3-5(4)11-6/h1-3H2,(H,9,10)
InChIKeyMDBJAVUQMPHOKH-UHFFFAOYSA-N
MW169.21 g/mol
LogP1.33
Rot. Bonds1

About 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid

5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid (PubChem CID 28950332) has the molecular formula C7H7NO2S and a molecular weight of 169.21 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid.

Molecular Properties

Compound Name5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid
PubChem CID28950332
Molecular FormulaC7H7NO2S
Molecular Weight169.21 g/mol
Exact Mass169.02
IUPAC Name5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid
SMILESO=C(O)c1nc2c(s1)CCC2
InChIInChI=1S/C7H7NO2S/c9-7(10)6-8-4-2-1-3-5(4)11-6/h1-3H2,(H,9,10)
InChIKeyMDBJAVUQMPHOKH-UHFFFAOYSA-N
XLogP1.33
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.21
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid?
The IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid (CID 28950332) is 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid.
What is the SMILES notation for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid?
The canonical SMILES for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid is O=C(O)c1nc2c(s1)CCC2.
What is the InChIKey of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid?
The InChIKey is MDBJAVUQMPHOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S/c9-7(10)6-8-4-2-1-3-5(4)11-6/h1-3H2,(H,9,10).
What are the key properties of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid?
5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid has a molecular weight of 169.21 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylic acid is sourced from PubChem (CID 28950332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).