About 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride
2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride (PubChem CID 28952) has the molecular formula C13H20Cl2N2O2
and a molecular weight of 307.22 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride |
| PubChem CID | 28952 |
| Molecular Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride |
| SMILES | O=c1cccccc1[NH2+]CC[NH+]1CCOCC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C13H18N2O2.2ClH/c16-13-5-3-1-2-4-12(13)14-6-7-15-8-10-17-11-9-15;;/h1-5H,6-11H2,(H,14,16);2*1H |
| InChIKey | OVQDUYMSWLDEJO-UHFFFAOYSA-N |
| XLogP | -7.84 |
| TPSA | 47.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | -7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride?
The IUPAC name of 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride (CID 28952) is 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride.
What is the SMILES notation for 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride?
The canonical SMILES for 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride is O=c1cccccc1[NH2+]CC[NH+]1CCOCC1.[Cl-].[Cl-].
What is the InChIKey of 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride?
The InChIKey is OVQDUYMSWLDEJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2.2ClH/c16-13-5-3-1-2-4-12(13)14-6-7-15-8-10-17-11-9-15;;/h1-5H,6-11H2,(H,14,16);2*1H.
What are the key properties of 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride?
2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride has a molecular weight of 307.22 g/mol, XLogP of -7.84, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ium-4-ylethyl-(7-oxocyclohepta-1,3,5-trien-1-yl)azanium dichloride is sourced from PubChem (CID 28952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).