1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid

C9H10N4O2 — CID 28952185

IUPAC1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid
SMILESCc1nn(C)c(-n2cccn2)c1C(=O)O
InChIInChI=1S/C9H10N4O2/c1-6-7(9(14)15)8(12(2)11-6)13-5-3-4-10-13/h3-5H,1-2H3,(H,14,15)
InChIKeyHRDMRGSQKSPROC-UHFFFAOYSA-N
MW206.21 g/mol
LogP0.61
Rot. Bonds2

About 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid

1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid (PubChem CID 28952185) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid.

Molecular Properties

Compound Name1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid
PubChem CID28952185
Molecular FormulaC9H10N4O2
Molecular Weight206.21 g/mol
Exact Mass206.08
IUPAC Name1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid
SMILESCc1nn(C)c(-n2cccn2)c1C(=O)O
InChIInChI=1S/C9H10N4O2/c1-6-7(9(14)15)8(12(2)11-6)13-5-3-4-10-13/h3-5H,1-2H3,(H,14,15)
InChIKeyHRDMRGSQKSPROC-UHFFFAOYSA-N
XLogP0.61
TPSA72.94 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.21
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid?
The IUPAC name of 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid (CID 28952185) is 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid.
What is the SMILES notation for 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid?
The canonical SMILES for 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid is Cc1nn(C)c(-n2cccn2)c1C(=O)O.
What is the InChIKey of 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid?
The InChIKey is HRDMRGSQKSPROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-6-7(9(14)15)8(12(2)11-6)13-5-3-4-10-13/h3-5H,1-2H3,(H,14,15).
What are the key properties of 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid?
1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid has a molecular weight of 206.21 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-pyrazol-1-ylpyrazole-4-carboxylic acid is sourced from PubChem (CID 28952185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).