About N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide
N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide (PubChem CID 28954216) has the molecular formula C18H32F3N3O
and a molecular weight of 363.47 g/mol. Its IUPAC name is N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide.
Molecular Properties
| Compound Name | N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide |
| PubChem CID | 28954216 |
| Molecular Formula | C18H32F3N3O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide |
| SMILES | CCN(CC1CCN(C2CCN(C)CC2)CC1)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C18H32F3N3O/c1-3-23(17(25)4-9-18(19,20)21)14-15-5-12-24(13-6-15)16-7-10-22(2)11-8-16/h15-16H,3-14H2,1-2H3 |
| InChIKey | DIIMVXFKWXSDHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide?
The IUPAC name of N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide (CID 28954216) is N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide.
What is the SMILES notation for N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide?
The canonical SMILES for N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide is CCN(CC1CCN(C2CCN(C)CC2)CC1)C(=O)CCC(F)(F)F.
What is the InChIKey of N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide?
The InChIKey is DIIMVXFKWXSDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32F3N3O/c1-3-23(17(25)4-9-18(19,20)21)14-15-5-12-24(13-6-15)16-7-10-22(2)11-8-16/h15-16H,3-14H2,1-2H3.
What are the key properties of N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide?
N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide has a molecular weight of 363.47 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4,4-trifluoro-N-[[1-(1-methylpiperidin-4-yl)piperidin-4-yl]methyl]butanamide is sourced from PubChem (CID 28954216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).