About 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate
1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate (PubChem CID 2895604) has the molecular formula C19H30O4S2
and a molecular weight of 386.58 g/mol. Its IUPAC name is 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate.
Molecular Properties
| Compound Name | 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate |
| PubChem CID | 2895604 |
| Molecular Formula | C19H30O4S2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate |
| SMILES | CCCCS(=O)CC(CS(=O)CCCC)OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H30O4S2/c1-4-6-12-24(21)14-18(15-25(22)13-7-5-2)23-19(20)17-10-8-16(3)9-11-17/h8-11,18H,4-7,12-15H2,1-3H3 |
| InChIKey | DNXQKCAJAHKMCV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate?
The IUPAC name of 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate (CID 2895604) is 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate.
What is the SMILES notation for 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate?
The canonical SMILES for 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate is CCCCS(=O)CC(CS(=O)CCCC)OC(=O)c1ccc(C)cc1.
What is the InChIKey of 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate?
The InChIKey is DNXQKCAJAHKMCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4S2/c1-4-6-12-24(21)14-18(15-25(22)13-7-5-2)23-19(20)17-10-8-16(3)9-11-17/h8-11,18H,4-7,12-15H2,1-3H3.
What are the key properties of 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate?
1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate has a molecular weight of 386.58 g/mol, XLogP of 3.62, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(butylsulfinyl)propan-2-yl 4-methylbenzoate is sourced from PubChem (CID 2895604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).