About 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one
2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one (PubChem CID 28957) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one |
| PubChem CID | 28957 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one |
| SMILES | CN(C)CCCNc1cccccc1=O |
| InChI | InChI=1S/C12H18N2O/c1-14(2)10-6-9-13-11-7-4-3-5-8-12(11)15/h3-5,7-8H,6,9-10H2,1-2H3,(H,13,15) |
| InChIKey | AESNJAUYRGTYAL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one (CID 28957) is 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one is CN(C)CCCNc1cccccc1=O.
What is the InChIKey of 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one?
The InChIKey is AESNJAUYRGTYAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-14(2)10-6-9-13-11-7-4-3-5-8-12(11)15/h3-5,7-8H,6,9-10H2,1-2H3,(H,13,15).
What are the key properties of 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one?
2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one has a molecular weight of 206.29 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(dimethylamino)propylamino]cyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 28957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).