C24H38FN3O — CID 28957404
2-[(2S)-1-(cyclohexylmethyl)-4-[1-(4-fluorophenyl)piperidin-4-yl]piperazin-2-yl]ethanol (PubChem CID 28957404) has the molecular formula C24H38FN3O and a molecular weight of 403.59 g/mol. Its IUPAC name is 2-[(2S)-1-(cyclohexylmethyl)-4-[1-(4-fluorophenyl)piperidin-4-yl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-(cyclohexylmethyl)-4-[1-(4-fluorophenyl)piperidin-4-yl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 28957404 |
| Molecular Formula | C24H38FN3O |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.30 |
| IUPAC Name | 2-[(2S)-1-(cyclohexylmethyl)-4-[1-(4-fluorophenyl)piperidin-4-yl]piperazin-2-yl]ethanol |
| SMILES | OCC[C@H]1CN(C2CCN(c3ccc(F)cc3)CC2)CCN1CC1CCCCC1 |
| InChI | InChI=1S/C24H38FN3O/c25-21-6-8-22(9-7-21)26-13-10-23(11-14-26)28-16-15-27(24(19-28)12-17-29)18-20-4-2-1-3-5-20/h6-9,20,23-24,29H,1-5,10-19H2/t24-/m0/s1 |
| InChIKey | LTMZNPJOHOZUQA-DEOSSOPVSA-N |
| XLogP | 3.74 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |