C22H34N4O — CID 28957439
1-[4-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]piperidin-1-yl]ethanone (PubChem CID 28957439) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-[4-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 28957439 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1-[4-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(N2CCC[C@@H](N3CCN(c4ccccc4)CC3)C2)CC1 |
| InChI | InChI=1S/C22H34N4O/c1-19(27)23-12-9-21(10-13-23)26-11-5-8-22(18-26)25-16-14-24(15-17-25)20-6-3-2-4-7-20/h2-4,6-7,21-22H,5,8-18H2,1H3/t22-/m1/s1 |
| InChIKey | FVHCOWVEGCAXFP-JOCHJYFZSA-N |
| XLogP | 2.28 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |