C23H17N5O4S — CID 2895777
6-[5-(3-nitrophenyl)furan-2-yl]-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 2895777) has the molecular formula C23H17N5O4S and a molecular weight of 459.49 g/mol. Its IUPAC name is 6-[5-(3-nitrophenyl)furan-2-yl]-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-[5-(3-nitrophenyl)furan-2-yl]-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 2895777 |
| Molecular Formula | C23H17N5O4S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 6-[5-(3-nitrophenyl)furan-2-yl]-3-prop-2-enylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | C=CCSc1nnc2c(n1)OC(c1ccc(-c3cccc([N+](=O)[O-])c3)o1)Nc1ccccc1-2 |
| InChI | InChI=1S/C23H17N5O4S/c1-2-12-33-23-25-22-20(26-27-23)16-8-3-4-9-17(16)24-21(32-22)19-11-10-18(31-19)14-6-5-7-15(13-14)28(29)30/h2-11,13,21,24H,1,12H2 |
| InChIKey | WGSVGCBCCNNGPV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|